C31H56N2O4 — CID 142247864
cis-(13R,15S)-4,13-dihydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine (PubChem CID 142247864) has the molecular formula C31H56N2O4 and a molecular weight of 520.80 g/mol. Its IUPAC name is cis-(13R,15S)-4,13-dihydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine.
| Compound Name | cis-(13R,15S)-4,13-dihydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine |
|---|---|
| PubChem CID | 142247864 |
| Molecular Formula | C31H56N2O4 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.42 |
| IUPAC Name | cis-(13R,15S)-4,13-dihydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione;N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine |
| SMILES | C/C=C\C(=C\C)\N=C(/C)CCC.CC1CCC[C@@H](O)C[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H37NO4.C11H19N/c1-13-7-6-8-16(22)10-14(2)12-21-18(24)11-17(23)20(4,5)19(25)15(3)9-13;1-5-8-10(4)12-11(7-3)9-6-2/h13-17,22-23H,6-12H2,1-5H3,(H,21,24);6-7,9H,5,8H2,1-4H3/b;9-6-,11-7-,12-10+/t13?,14-,15?,16+,17?;/m0./s1 |
| InChIKey | JHCUKXKPUBLTCF-MUNQGVRASA-N |
| XLogP | 6.41 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|