C35H60N2O3 — CID 142247824
(Z)-1-cyclobutyl-N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pent-3-en-1-imine;(15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione (PubChem CID 142247824) has the molecular formula C35H60N2O3 and a molecular weight of 556.88 g/mol. Its IUPAC name is (Z)-1-cyclobutyl-N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pent-3-en-1-imine;(15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione.
| Compound Name | (Z)-1-cyclobutyl-N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pent-3-en-1-imine;(15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione |
|---|---|
| PubChem CID | 142247824 |
| Molecular Formula | C35H60N2O3 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.46 |
| IUPAC Name | (Z)-1-cyclobutyl-N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pent-3-en-1-imine;(15S)-4-hydroxy-5,5,7,9,15-pentamethyl-azacyclohexadecane-2,6-dione |
| SMILES | C/C=C\C/C(=N\C(\C=C/C)=C/C)C1CCC1.CC1CCCCC[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H37NO3.C15H23N/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14;1-4-7-12-15(13-10-8-11-13)16-14(6-3)9-5-2/h14-17,22H,6-13H2,1-5H3,(H,21,23);4-7,9,13H,8,10-12H2,1-3H3/b;7-4-,9-5-,14-6-,16-15+/t14?,15-,16?,17?;/m0./s1 |
| InChIKey | MLQCHBCIOBPZEU-DSJBVTIMSA-N |
| XLogP | 8.39 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|