C32H54N2O3 — CID 142177251
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142177251) has the molecular formula C32H54N2O3 and a molecular weight of 514.80 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142177251 |
| Molecular Formula | C32H54N2O3 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;(4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | C/C=C\C(=C\C)\N=C(/C)CCC.CC1=C\CCN(C)C(=O)C[C@H](O)C(C)(C)C(=O)C(C)CC(C)C\C=C\1 |
| InChI | InChI=1S/C21H35NO3.C11H19N/c1-15-9-7-10-16(2)13-17(3)20(25)21(4,5)18(23)14-19(24)22(6)12-8-11-15;1-5-8-10(4)12-11(7-3)9-6-2/h7,9,11,16-18,23H,8,10,12-14H2,1-6H3;6-7,9H,5,8H2,1-4H3/b9-7+,15-11+;9-6-,11-7-,12-10+/t16?,17?,18-;/m0./s1 |
| InChIKey | FBWSKLLXWCIOSH-WCAYSTEBSA-N |
| XLogP | 7.48 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|