C31H52N2O3 — CID 142247854
2,5-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydro-3H-azepine;(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 142247854) has the molecular formula C31H52N2O3 and a molecular weight of 500.77 g/mol. Its IUPAC name is 2,5-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydro-3H-azepine;(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | 2,5-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydro-3H-azepine;(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142247854 |
| Molecular Formula | C31H52N2O3 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | 2,5-dimethyl-7-[(Z)-prop-1-enyl]-4,5-dihydro-3H-azepine;(13Z,15S)-4-hydroxy-5,5,7,9,15-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C=C\C1=CC(C)CCC(C)=N1.CC1CCC/C=C\[C@H](C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C20H35NO3.C11H17N/c1-14-9-7-6-8-10-15(2)13-21-18(23)12-17(22)20(4,5)19(24)16(3)11-14;1-4-5-11-8-9(2)6-7-10(3)12-11/h8,10,14-17,22H,6-7,9,11-13H2,1-5H3,(H,21,23);4-5,8-9H,6-7H2,1-3H3/b10-8-;5-4-/t14?,15-,16?,17?;/m0./s1 |
| InChIKey | PXGNJPHNBYHMSX-FLYNRXHISA-N |
| XLogP | 6.82 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|