C24H43N — CID 57047712
5-(2,6-dimethylhepta-1,5-dienyl)-8,12-dimethyltrideca-7,11-dien-1-amine (PubChem CID 57047712) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is 5-(2,6-dimethylhepta-1,5-dienyl)-8,12-dimethyltrideca-7,11-dien-1-amine.
| Compound Name | 5-(2,6-dimethylhepta-1,5-dienyl)-8,12-dimethyltrideca-7,11-dien-1-amine |
|---|---|
| PubChem CID | 57047712 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | 5-(2,6-dimethylhepta-1,5-dienyl)-8,12-dimethyltrideca-7,11-dien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCC(C=C(C)CCC=C(C)C)CCCCN |
| InChI | InChI=1S/C24H43N/c1-20(2)11-9-13-22(5)16-17-24(15-7-8-18-25)19-23(6)14-10-12-21(3)4/h11-12,16,19,24H,7-10,13-15,17-18,25H2,1-6H3 |
| InChIKey | VCEAIVFCQLBXMD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|