C14H18O5P+ — CID 57047837
benzyl-dihydroxy-(5-propanoyloxy-2,3-dihydrofuran-4-yl)phosphanium (PubChem CID 57047837) has the molecular formula C14H18O5P+ and a molecular weight of 297.27 g/mol. Its IUPAC name is benzyl-dihydroxy-(5-propanoyloxy-2,3-dihydrofuran-4-yl)phosphanium.
| Compound Name | benzyl-dihydroxy-(5-propanoyloxy-2,3-dihydrofuran-4-yl)phosphanium |
|---|---|
| PubChem CID | 57047837 |
| Molecular Formula | C14H18O5P+ |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | benzyl-dihydroxy-(5-propanoyloxy-2,3-dihydrofuran-4-yl)phosphanium |
| SMILES | CCC(=O)OC1=C([P+](O)(O)Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C14H18O5P/c1-2-13(15)19-14-12(8-9-18-14)20(16,17)10-11-6-4-3-5-7-11/h3-7,16-17H,2,8-10H2,1H3/q+1 |
| InChIKey | UKURKXWCWWAECI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|