C19H26O3 — CID 57048854
1-[3-(cyclopentyloxymethoxy)phenyl]cyclohexane-1-carbaldehyde (PubChem CID 57048854) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 1-[3-(cyclopentyloxymethoxy)phenyl]cyclohexane-1-carbaldehyde.
| Compound Name | 1-[3-(cyclopentyloxymethoxy)phenyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 57048854 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-[3-(cyclopentyloxymethoxy)phenyl]cyclohexane-1-carbaldehyde |
| SMILES | O=CC1(c2cccc(OCOC3CCCC3)c2)CCCCC1 |
| InChI | InChI=1S/C19H26O3/c20-14-19(11-4-1-5-12-19)16-7-6-10-18(13-16)22-15-21-17-8-2-3-9-17/h6-7,10,13-14,17H,1-5,8-9,11-12,15H2 |
| InChIKey | BIBHFGQCNXRFNQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|