C9H22N3O6S3- — CID 57049644
1-(ethylsulfamoyl)-2-[[ethyl(sulfinato)amino]methylsulfonylamino]-2-methylpropane (PubChem CID 57049644) has the molecular formula C9H22N3O6S3- and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(ethylsulfamoyl)-2-[[ethyl(sulfinato)amino]methylsulfonylamino]-2-methylpropane.
| Compound Name | 1-(ethylsulfamoyl)-2-[[ethyl(sulfinato)amino]methylsulfonylamino]-2-methylpropane |
|---|---|
| PubChem CID | 57049644 |
| Molecular Formula | C9H22N3O6S3- |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-(ethylsulfamoyl)-2-[[ethyl(sulfinato)amino]methylsulfonylamino]-2-methylpropane |
| SMILES | CCNS(=O)(=O)CC(C)(C)NS(=O)(=O)CN(CC)S(=O)[O-] |
| InChI | InChI=1S/C9H23N3O6S3/c1-5-10-20(15,16)7-9(3,4)11-21(17,18)8-12(6-2)19(13)14/h10-11H,5-8H2,1-4H3,(H,13,14)/p-1 |
| InChIKey | IIXDJAAWQTVMRU-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|