C20H18Cl4O2 — CID 57051151
1,1-bis(3,5-dichlorophenyl)propan-2-yl 2-methylbut-2-enoate (PubChem CID 57051151) has the molecular formula C20H18Cl4O2 and a molecular weight of 432.17 g/mol. Its IUPAC name is 1,1-bis(3,5-dichlorophenyl)propan-2-yl 2-methylbut-2-enoate.
| Compound Name | 1,1-bis(3,5-dichlorophenyl)propan-2-yl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 57051151 |
| Molecular Formula | C20H18Cl4O2 |
| Molecular Weight | 432.17 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 1,1-bis(3,5-dichlorophenyl)propan-2-yl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC(C)C(c1cc(Cl)cc(Cl)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H18Cl4O2/c1-4-11(2)20(25)26-12(3)19(13-5-15(21)9-16(22)6-13)14-7-17(23)10-18(24)8-14/h4-10,12,19H,1-3H3 |
| InChIKey | YVUTWYNFUWPCSY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.17 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|