C7H12O2S3 — CID 173491072
1,2,2-tris(sulfanyl)ethyl 2-methylbut-2-enoate (PubChem CID 173491072) has the molecular formula C7H12O2S3 and a molecular weight of 224.37 g/mol. Its IUPAC name is 1,2,2-tris(sulfanyl)ethyl 2-methylbut-2-enoate.
| Compound Name | 1,2,2-tris(sulfanyl)ethyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 173491072 |
| Molecular Formula | C7H12O2S3 |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 1,2,2-tris(sulfanyl)ethyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC(S)C(S)S |
| InChI | InChI=1S/C7H12O2S3/c1-3-4(2)5(8)9-6(10)7(11)12/h3,6-7,10-12H,1-2H3 |
| InChIKey | RPGBHPBBSVGEIX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|