C19H23N3O2S — CID 57051799
3-amino-N-[1-(1-phenylethyl)-3,4-dihydro-2H-pyridin-6-yl]benzenesulfonamide (PubChem CID 57051799) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-amino-N-[1-(1-phenylethyl)-3,4-dihydro-2H-pyridin-6-yl]benzenesulfonamide.
| Compound Name | 3-amino-N-[1-(1-phenylethyl)-3,4-dihydro-2H-pyridin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57051799 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-amino-N-[1-(1-phenylethyl)-3,4-dihydro-2H-pyridin-6-yl]benzenesulfonamide |
| SMILES | CC(c1ccccc1)N1CCCC=C1NS(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C19H23N3O2S/c1-15(16-8-3-2-4-9-16)22-13-6-5-12-19(22)21-25(23,24)18-11-7-10-17(20)14-18/h2-4,7-12,14-15,21H,5-6,13,20H2,1H3 |
| InChIKey | UKZYYKWCDFUABJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|