About oxolan-2-ylmethyl pentanedithioate
oxolan-2-ylmethyl pentanedithioate (PubChem CID 57053848) has the molecular formula C10H18OS2
and a molecular weight of 218.39 g/mol. Its IUPAC name is oxolan-2-ylmethyl pentanedithioate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl pentanedithioate |
| PubChem CID | 57053848 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | oxolan-2-ylmethyl pentanedithioate |
| SMILES | CCCCC(=S)SCC1CCCO1 |
| InChI | InChI=1S/C10H18OS2/c1-2-3-6-10(12)13-8-9-5-4-7-11-9/h9H,2-8H2,1H3 |
| InChIKey | YCIRAHKBJJHYFX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-ylmethyl pentanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl pentanedithioate?
The IUPAC name of oxolan-2-ylmethyl pentanedithioate (CID 57053848) is oxolan-2-ylmethyl pentanedithioate.
What is the SMILES notation for oxolan-2-ylmethyl pentanedithioate?
The canonical SMILES for oxolan-2-ylmethyl pentanedithioate is CCCCC(=S)SCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethyl pentanedithioate?
The InChIKey is YCIRAHKBJJHYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS2/c1-2-3-6-10(12)13-8-9-5-4-7-11-9/h9H,2-8H2,1H3.
What are the key properties of oxolan-2-ylmethyl pentanedithioate?
oxolan-2-ylmethyl pentanedithioate has a molecular weight of 218.39 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl pentanedithioate is sourced from PubChem (CID 57053848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).