C8H11NO3 — CID 57054355
2-[(dimethylamino)methyl]-3-hydroxypyran-4-one (PubChem CID 57054355) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-3-hydroxypyran-4-one.
| Compound Name | 2-[(dimethylamino)methyl]-3-hydroxypyran-4-one |
|---|---|
| PubChem CID | 57054355 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-[(dimethylamino)methyl]-3-hydroxypyran-4-one |
| SMILES | CN(C)Cc1occc(=O)c1O |
| InChI | InChI=1S/C8H11NO3/c1-9(2)5-7-8(11)6(10)3-4-12-7/h3-4,11H,5H2,1-2H3 |
| InChIKey | BNIFUYSYNQWJAJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |