C17H20N2O3 — CID 57057226
3-hydroxy-2-[(4-phenoxyphenyl)methylamino]butanamide (PubChem CID 57057226) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-hydroxy-2-[(4-phenoxyphenyl)methylamino]butanamide.
| Compound Name | 3-hydroxy-2-[(4-phenoxyphenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 57057226 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-hydroxy-2-[(4-phenoxyphenyl)methylamino]butanamide |
| SMILES | CC(O)C(NCc1ccc(Oc2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C17H20N2O3/c1-12(20)16(17(18)21)19-11-13-7-9-15(10-8-13)22-14-5-3-2-4-6-14/h2-10,12,16,19-20H,11H2,1H3,(H2,18,21) |
| InChIKey | TUKILHAVJWZNEN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |