C19H17FO3 — CID 57058386
ethyl 2-(2,3-dihydro-1-benzofuran-4-yl)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 57058386) has the molecular formula C19H17FO3 and a molecular weight of 312.34 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1-benzofuran-4-yl)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | ethyl 2-(2,3-dihydro-1-benzofuran-4-yl)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 57058386 |
| Molecular Formula | C19H17FO3 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 2-(2,3-dihydro-1-benzofuran-4-yl)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1ccc(F)cc1)c1cccc2c1CCO2 |
| InChI | InChI=1S/C19H17FO3/c1-2-22-19(21)17(12-13-6-8-14(20)9-7-13)15-4-3-5-18-16(15)10-11-23-18/h3-9,12H,2,10-11H2,1H3 |
| InChIKey | FVGAGCGPLVLZJX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|