C44H81NO6 — CID 57058519
[3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-octadec-9-enoyloxypropyl] octadec-9-enoate (PubChem CID 57058519) has the molecular formula C44H81NO6 and a molecular weight of 720.13 g/mol. Its IUPAC name is [3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-octadec-9-enoyloxypropyl] octadec-9-enoate.
| Compound Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-octadec-9-enoyloxypropyl] octadec-9-enoate |
|---|---|
| PubChem CID | 57058519 |
| Molecular Formula | C44H81NO6 |
| Molecular Weight | 720.13 g/mol |
| Exact Mass | 719.61 |
| IUPAC Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-octadec-9-enoyloxypropyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCC(NC(=O)OC(C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C44H81NO6/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(46)49-39-38-40(45-43(48)51-44(3,4)5)50-42(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,40H,6-19,24-39H2,1-5H3,(H,45,48) |
| InChIKey | OCDLGHUEEKLQAE-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.13 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|