C20H37NO4 — CID 134983456
methyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-5-enoate (PubChem CID 134983456) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is methyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-5-enoate.
| Compound Name | methyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-5-enoate |
|---|---|
| PubChem CID | 134983456 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | methyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-5-enoate |
| SMILES | CCCCCCCC/C=C/C[C@@H](CC(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO4/c1-6-7-8-9-10-11-12-13-14-15-17(16-18(22)24-5)21-19(23)25-20(2,3)4/h13-14,17H,6-12,15-16H2,1-5H3,(H,21,23)/b14-13+/t17-/m0/s1 |
| InChIKey | NFCDOQDTJXJDOV-CLVCIHKQSA-N |
| XLogP | 5.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|