C18H33NO4 — CID 10925471
methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-5-enoate (PubChem CID 10925471) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-5-enoate.
| Compound Name | methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-5-enoate |
|---|---|
| PubChem CID | 10925471 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-5-enoate |
| SMILES | CCCCCC/C=C/CCC(NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H33NO4/c1-6-7-8-9-10-11-12-13-14-15(16(20)22-5)19-17(21)23-18(2,3)4/h11-12,15H,6-10,13-14H2,1-5H3,(H,19,21)/b12-11+ |
| InChIKey | JTZMWVCZGPYJNV-VAWYXSNFSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|