C20H23NO5S2 — CID 57059798
5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylic acid (PubChem CID 57059798) has the molecular formula C20H23NO5S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 57059798 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylic acid |
| SMILES | CS(=O)(=O)C(CCCc1ccco1)(CCc1ccc(C(=O)O)s1)c1ccc[nH]1 |
| InChI | InChI=1S/C20H23NO5S2/c1-28(24,25)20(18-7-3-13-21-18,11-2-5-15-6-4-14-26-15)12-10-16-8-9-17(27-16)19(22)23/h3-4,6-9,13-14,21H,2,5,10-12H2,1H3,(H,22,23) |
| InChIKey | HNBDLKVYLIKLHU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |