C21H25NO5S2 — CID 57255187
methyl 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylate (PubChem CID 57255187) has the molecular formula C21H25NO5S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is methyl 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 57255187 |
| Molecular Formula | C21H25NO5S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | methyl 5-[6-(furan-2-yl)-3-methylsulfonyl-3-(1H-pyrrol-2-yl)hexyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC(CCCc2ccco2)(c2ccc[nH]2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C21H25NO5S2/c1-26-20(23)18-10-9-17(28-18)11-13-21(29(2,24)25,19-8-4-14-22-19)12-3-6-16-7-5-15-27-16/h4-5,7-10,14-15,22H,3,6,11-13H2,1-2H3 |
| InChIKey | MXUSDBQYISTUCZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |