C15H30O3 — CID 57061456
(2S,4S,5S)-2-(heptoxymethyl)-4-methoxy-5-methyloxane (PubChem CID 57061456) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (2S,4S,5S)-2-(heptoxymethyl)-4-methoxy-5-methyloxane.
| Compound Name | (2S,4S,5S)-2-(heptoxymethyl)-4-methoxy-5-methyloxane |
|---|---|
| PubChem CID | 57061456 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (2S,4S,5S)-2-(heptoxymethyl)-4-methoxy-5-methyloxane |
| SMILES | CCCCCCCOC[C@@H]1C[C@H](OC)[C@@H](C)CO1 |
| InChI | InChI=1S/C15H30O3/c1-4-5-6-7-8-9-17-12-14-10-15(16-3)13(2)11-18-14/h13-15H,4-12H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | OVKFKQHSAPRHKG-KKUMJFAQSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|