C12H16Cl2N2O — CID 57061640
3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine (PubChem CID 57061640) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine.
| Compound Name | 3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine |
|---|---|
| PubChem CID | 57061640 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine |
| SMILES | Clc1cnc(OCCC2CCCCN2)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O/c13-9-7-11(14)12(16-8-9)17-6-4-10-3-1-2-5-15-10/h7-8,10,15H,1-6H2 |
| InChIKey | CYADITBPTAOPGO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |