C13H16Cl2N2O3 — CID 57127962
3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine-4-carboxylic acid (PubChem CID 57127962) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine-4-carboxylic acid.
| Compound Name | 3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 57127962 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3,5-dichloro-2-(2-piperidin-2-ylethoxy)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1c(Cl)cnc(OCCC2CCCCN2)c1Cl |
| InChI | InChI=1S/C13H16Cl2N2O3/c14-9-7-17-12(11(15)10(9)13(18)19)20-6-4-8-3-1-2-5-16-8/h7-8,16H,1-6H2,(H,18,19) |
| InChIKey | XKVQHNKBCIXSRR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |