C11H14N2 — CID 57065031
1-(2,4-dimethylcyclohexa-1,5-dien-1-yl)imidazole (PubChem CID 57065031) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-(2,4-dimethylcyclohexa-1,5-dien-1-yl)imidazole.
| Compound Name | 1-(2,4-dimethylcyclohexa-1,5-dien-1-yl)imidazole |
|---|---|
| PubChem CID | 57065031 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(2,4-dimethylcyclohexa-1,5-dien-1-yl)imidazole |
| SMILES | CC1=C(n2ccnc2)C=CC(C)C1 |
| InChI | InChI=1S/C11H14N2/c1-9-3-4-11(10(2)7-9)13-6-5-12-8-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | SBMVXACJNOVMCE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |