C18H26O2 — CID 57066601
(3aS,9aS,9bS)-3-ethylidene-3a-methylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane] (PubChem CID 57066601) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (3aS,9aS,9bS)-3-ethylidene-3a-methylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane].
| Compound Name | (3aS,9aS,9bS)-3-ethylidene-3a-methylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 57066601 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (3aS,9aS,9bS)-3-ethylidene-3a-methylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane] |
| SMILES | CC=C1CC[C@H]2[C@@H]3CCC4(CC3=CC[C@]12C)OCCO4 |
| InChI | InChI=1S/C18H26O2/c1-3-14-4-5-16-15-7-9-18(19-10-11-20-18)12-13(15)6-8-17(14,16)2/h3,6,15-16H,4-5,7-12H2,1-2H3/t15-,16+,17-/m1/s1 |
| InChIKey | NCBIGABEHYEPIW-IXDOHACOSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|