C21H29FO3 — CID 18635394
(3aS)-4-fluoro-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane]-11b-ol (PubChem CID 18635394) has the molecular formula C21H29FO3 and a molecular weight of 348.46 g/mol. Its IUPAC name is (3aS)-4-fluoro-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane]-11b-ol.
| Compound Name | (3aS)-4-fluoro-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane]-11b-ol |
|---|---|
| PubChem CID | 18635394 |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (3aS)-4-fluoro-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane]-11b-ol |
| SMILES | CC1=C2CC3(CCC2CC2C1=CC(F)[C@@]1(C)CCCC21O)OCCO3 |
| InChI | InChI=1S/C21H29FO3/c1-13-15-11-18(22)19(2)5-3-6-21(19,23)17(15)10-14-4-7-20(12-16(13)14)24-8-9-25-20/h11,14,17-18,23H,3-10,12H2,1-2H3/t14?,17?,18?,19-,21?/m1/s1 |
| InChIKey | HUEAAKQLFVXFEY-ITMZPOEDSA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |