About 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane
2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane (PubChem CID 57067055) has the molecular formula C9H8F8
and a molecular weight of 268.15 g/mol. Its IUPAC name is 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane |
| PubChem CID | 57067055 |
| Molecular Formula | C9H8F8 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane |
| SMILES | FC(F)(F)C1(F)C2CCC(C2)C1(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F8/c10-6(8(12,13)14)4-1-2-5(3-4)7(6,11)9(15,16)17/h4-5H,1-3H2 |
| InChIKey | JPYIHLUWEIJMHH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane?
The IUPAC name of 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane (CID 57067055) is 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane.
What is the SMILES notation for 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane?
The canonical SMILES for 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane is FC(F)(F)C1(F)C2CCC(C2)C1(F)C(F)(F)F.
What is the InChIKey of 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane?
The InChIKey is JPYIHLUWEIJMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F8/c10-6(8(12,13)14)4-1-2-5(3-4)7(6,11)9(15,16)17/h4-5H,1-3H2.
What are the key properties of 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane?
2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane has a molecular weight of 268.15 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-2,3-bis(trifluoromethyl)bicyclo[2.2.1]heptane is sourced from PubChem (CID 57067055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).