C4H2Cl2F2 — CID 57069334
1,2-dichloro-3,4-difluorocyclobutene (PubChem CID 57069334) has the molecular formula C4H2Cl2F2 and a molecular weight of 158.96 g/mol. Its IUPAC name is 1,2-dichloro-3,4-difluorocyclobutene.
| Compound Name | 1,2-dichloro-3,4-difluorocyclobutene |
|---|---|
| PubChem CID | 57069334 |
| Molecular Formula | C4H2Cl2F2 |
| Molecular Weight | 158.96 g/mol |
| Exact Mass | 157.95 |
| IUPAC Name | 1,2-dichloro-3,4-difluorocyclobutene |
| SMILES | FC1C(Cl)=C(Cl)C1F |
| InChI | InChI=1S/C4H2Cl2F2/c5-1-2(6)4(8)3(1)7/h3-4H |
| InChIKey | IDYQVKRHWARUJP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.96 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |