C10H8N2O3S — CID 57069961
2-(1H-benzimidazol-2-yl)-3-oxo-3-sulfanylpropanoic acid (PubChem CID 57069961) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-oxo-3-sulfanylpropanoic acid.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-oxo-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57069961 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-oxo-3-sulfanylpropanoic acid |
| SMILES | O=C(O)C(C(=O)S)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H8N2O3S/c13-9(14)7(10(15)16)8-11-5-3-1-2-4-6(5)12-8/h1-4,7H,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | PDSCVDBVKKVXFG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|