(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid

C10H10N2O4 — CID 785137

IUPAC(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid
SMILESO=C(O)[C@H](O)[C@@H](O)c1nc2ccccc2[nH]1
InChIInChI=1S/C10H10N2O4/c13-7(8(14)10(15)16)9-11-5-3-1-2-4-6(5)12-9/h1-4,7-8,13-14H,(H,11,12)(H,15,16)/t7-,8-/m1/s1
InChIKeyFUOWVFMEVIDAKH-HTQZYQBOSA-N
MW222.20 g/mol
LogP0.04
Rot. Bonds3

About (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid

(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid (PubChem CID 785137) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid.

Molecular Properties

Compound Name(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid
PubChem CID785137
Molecular FormulaC10H10N2O4
Molecular Weight222.20 g/mol
Exact Mass222.06
IUPAC Name(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid
SMILESO=C(O)[C@H](O)[C@@H](O)c1nc2ccccc2[nH]1
InChIInChI=1S/C10H10N2O4/c13-7(8(14)10(15)16)9-11-5-3-1-2-4-6(5)12-9/h1-4,7-8,13-14H,(H,11,12)(H,15,16)/t7-,8-/m1/s1
InChIKeyFUOWVFMEVIDAKH-HTQZYQBOSA-N
XLogP0.04
TPSA106.44 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.20
LogP ≤ 50.04
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid?
The IUPAC name of (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid (CID 785137) is (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid.
What is the SMILES notation for (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid?
The canonical SMILES for (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid is O=C(O)[C@H](O)[C@@H](O)c1nc2ccccc2[nH]1.
What is the InChIKey of (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid?
The InChIKey is FUOWVFMEVIDAKH-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H10N2O4/c13-7(8(14)10(15)16)9-11-5-3-1-2-4-6(5)12-9/h1-4,7-8,13-14H,(H,11,12)(H,15,16)/t7-,8-/m1/s1.
What are the key properties of (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid?
(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid has a molecular weight of 222.20 g/mol, XLogP of 0.04, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 785137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).