C10H10N2O4 — CID 785137
(2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid (PubChem CID 785137) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid.
| Compound Name | (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 785137 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (2R,3S)-3-(1H-benzimidazol-2-yl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H10N2O4/c13-7(8(14)10(15)16)9-11-5-3-1-2-4-6(5)12-9/h1-4,7-8,13-14H,(H,11,12)(H,15,16)/t7-,8-/m1/s1 |
| InChIKey | FUOWVFMEVIDAKH-HTQZYQBOSA-N |
| XLogP | 0.04 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |