C10H5ClF3NO — CID 57070349
4-chloro-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole (PubChem CID 57070349) has the molecular formula C10H5ClF3NO and a molecular weight of 247.60 g/mol. Its IUPAC name is 4-chloro-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole.
| Compound Name | 4-chloro-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 57070349 |
| Molecular Formula | C10H5ClF3NO |
| Molecular Weight | 247.60 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 4-chloro-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole |
| SMILES | FC(F)(F)c1ccc(-c2nocc2Cl)cc1 |
| InChI | InChI=1S/C10H5ClF3NO/c11-8-5-16-15-9(8)6-1-3-7(4-2-6)10(12,13)14/h1-5H |
| InChIKey | DVCIEPRWICCVFZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |