C23H8F12N2O3 — CID 174726964
bis[4-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]methanone (PubChem CID 174726964) has the molecular formula C23H8F12N2O3 and a molecular weight of 588.30 g/mol. Its IUPAC name is bis[4-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]methanone.
| Compound Name | bis[4-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 174726964 |
| Molecular Formula | C23H8F12N2O3 |
| Molecular Weight | 588.30 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | bis[4-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]methanone |
| SMILES | O=C(c1onc(-c2ccc(C(F)(F)F)cc2)c1C(F)(F)F)c1onc(-c2ccc(C(F)(F)F)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C23H8F12N2O3/c24-20(25,26)11-5-1-9(2-6-11)15-13(22(30,31)32)18(39-36-15)17(38)19-14(23(33,34)35)16(37-40-19)10-3-7-12(8-4-10)21(27,28)29/h1-8H |
| InChIKey | DJCONIVJMCYYRC-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.30 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |