About bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone
bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone (PubChem CID 174727062) has the molecular formula C21H8Br2F6N2O3
and a molecular weight of 610.10 g/mol. Its IUPAC name is bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone.
Molecular Properties
| Compound Name | bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone |
| PubChem CID | 174727062 |
| Molecular Formula | C21H8Br2F6N2O3 |
| Molecular Weight | 610.10 g/mol |
| Exact Mass | 607.88 |
| IUPAC Name | bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone |
| SMILES | O=C(c1onc(-c2ccc(Br)cc2)c1C(F)(F)F)c1onc(-c2ccc(Br)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C21H8Br2F6N2O3/c22-11-5-1-9(2-6-11)15-13(20(24,25)26)18(33-30-15)17(32)19-14(21(27,28)29)16(31-34-19)10-3-7-12(23)8-4-10/h1-8H |
| InChIKey | CCAQITBYAOAHKF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.10 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone?
The IUPAC name of bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone (CID 174727062) is bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone.
What is the SMILES notation for bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone?
The canonical SMILES for bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone is O=C(c1onc(-c2ccc(Br)cc2)c1C(F)(F)F)c1onc(-c2ccc(Br)cc2)c1C(F)(F)F.
What is the InChIKey of bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone?
The InChIKey is CCAQITBYAOAHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H8Br2F6N2O3/c22-11-5-1-9(2-6-11)15-13(20(24,25)26)18(33-30-15)17(32)19-14(21(27,28)29)16(31-34-19)10-3-7-12(23)8-4-10/h1-8H.
What are the key properties of bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone?
bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone has a molecular weight of 610.10 g/mol, XLogP of 7.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone is sourced from PubChem (CID 174727062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).