C21H8Br2F6N2O3 — CID 174727062
bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone (PubChem CID 174727062) has the molecular formula C21H8Br2F6N2O3 and a molecular weight of 610.10 g/mol. Its IUPAC name is bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone.
| Compound Name | bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 174727062 |
| Molecular Formula | C21H8Br2F6N2O3 |
| Molecular Weight | 610.10 g/mol |
| Exact Mass | 607.88 |
| IUPAC Name | bis[3-(4-bromophenyl)-4-(trifluoromethyl)-1,2-oxazol-5-yl]methanone |
| SMILES | O=C(c1onc(-c2ccc(Br)cc2)c1C(F)(F)F)c1onc(-c2ccc(Br)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C21H8Br2F6N2O3/c22-11-5-1-9(2-6-11)15-13(20(24,25)26)18(33-30-15)17(32)19-14(21(27,28)29)16(31-34-19)10-3-7-12(23)8-4-10/h1-8H |
| InChIKey | CCAQITBYAOAHKF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.10 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |