C16H16ClF3N2O2 — CID 91304852
4-(4-chloro-3-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 91304852) has the molecular formula C16H16ClF3N2O2 and a molecular weight of 360.76 g/mol. Its IUPAC name is 4-(4-chloro-3-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 4-(4-chloro-3-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91304852 |
| Molecular Formula | C16H16ClF3N2O2 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-(4-chloro-3-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | CC(CCl)C(C)c1c(-c2ccc(C(F)(F)F)cc2)noc1C(N)=O |
| InChI | InChI=1S/C16H16ClF3N2O2/c1-8(7-17)9(2)12-13(22-24-14(12)15(21)23)10-3-5-11(6-4-10)16(18,19)20/h3-6,8-9H,7H2,1-2H3,(H2,21,23) |
| InChIKey | FSHZSQWWAIJMOO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|