C16H22O8 — CID 57073274
4-(2-carboxyethylidene)dec-5-ene-1,5,10-tricarboxylic acid (PubChem CID 57073274) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 4-(2-carboxyethylidene)dec-5-ene-1,5,10-tricarboxylic acid.
| Compound Name | 4-(2-carboxyethylidene)dec-5-ene-1,5,10-tricarboxylic acid |
|---|---|
| PubChem CID | 57073274 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-(2-carboxyethylidene)dec-5-ene-1,5,10-tricarboxylic acid |
| SMILES | O=C(O)CC=C(CCCC(=O)O)C(=CCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22O8/c17-13(18)7-3-1-2-6-12(16(23)24)11(9-10-15(21)22)5-4-8-14(19)20/h6,9H,1-5,7-8,10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | WVRXMZGHHYHZJD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|