C15H24N4O2 — CID 57073623
3-nitro-N-(5-piperidin-2-ylpentyl)pyridin-2-amine (PubChem CID 57073623) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-nitro-N-(5-piperidin-2-ylpentyl)pyridin-2-amine.
| Compound Name | 3-nitro-N-(5-piperidin-2-ylpentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 57073623 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-nitro-N-(5-piperidin-2-ylpentyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NCCCCCC1CCCCN1 |
| InChI | InChI=1S/C15H24N4O2/c20-19(21)14-9-6-12-18-15(14)17-11-4-1-2-7-13-8-3-5-10-16-13/h6,9,12-13,16H,1-5,7-8,10-11H2,(H,17,18) |
| InChIKey | JAEALOLYKIJDTP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|