C21H30O3 — CID 57074129
1-[(3R,6S,7S,10S,11R,18R)-16-hydroxy-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-3-yl]ethanone (PubChem CID 57074129) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(3R,6S,7S,10S,11R,18R)-16-hydroxy-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-3-yl]ethanone.
| Compound Name | 1-[(3R,6S,7S,10S,11R,18R)-16-hydroxy-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-3-yl]ethanone |
|---|---|
| PubChem CID | 57074129 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[(3R,6S,7S,10S,11R,18R)-16-hydroxy-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-3-yl]ethanone |
| SMILES | CC(=O)[C@]12CC[C@H]3[C@@H]4CC=C5CC(O)CC(O1)[C@]5(C)[C@H]4CC[C@@]32C |
| InChI | InChI=1S/C21H30O3/c1-12(22)21-9-7-16-15-5-4-13-10-14(23)11-18(24-21)20(13,3)17(15)6-8-19(16,21)2/h4,14-18,23H,5-11H2,1-3H3/t14?,15-,16-,17-,18?,19-,20-,21-/m0/s1 |
| InChIKey | GHHTXMRRHGRCEK-IVWMZAKGSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|