C23H32O4 — CID 57206898
[(3R,6S,7S,10S,11R,18R)-3-acetyl-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-16-yl] acetate (PubChem CID 57206898) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(3R,6S,7S,10S,11R,18R)-3-acetyl-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-16-yl] acetate.
| Compound Name | [(3R,6S,7S,10S,11R,18R)-3-acetyl-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-16-yl] acetate |
|---|---|
| PubChem CID | 57206898 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(3R,6S,7S,10S,11R,18R)-3-acetyl-7,18-dimethyl-2-oxapentacyclo[8.7.1.03,7.06,11.014,18]octadec-13-en-16-yl] acetate |
| SMILES | CC(=O)OC1CC2=CC[C@H]3[C@@H]4CC[C@@]5(C(C)=O)OC(C1)[C@]2(C)[C@H]3CC[C@@]45C |
| InChI | InChI=1S/C23H32O4/c1-13(24)23-10-8-18-17-6-5-15-11-16(26-14(2)25)12-20(27-23)22(15,4)19(17)7-9-21(18,23)3/h5,16-20H,6-12H2,1-4H3/t16?,17-,18-,19-,20?,21-,22-,23-/m0/s1 |
| InChIKey | CEUIXMYXEYYTFH-WVSPMJEXSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|