C14H16N2O5 — CID 57074307
1-[6-(2,5-dihydroxypyrrol-1-yl)-6-oxohexyl]pyrrole-2,5-dione (PubChem CID 57074307) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-[6-(2,5-dihydroxypyrrol-1-yl)-6-oxohexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-(2,5-dihydroxypyrrol-1-yl)-6-oxohexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57074307 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-[6-(2,5-dihydroxypyrrol-1-yl)-6-oxohexyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCC(=O)n1c(O)ccc1O |
| InChI | InChI=1S/C14H16N2O5/c17-10-5-6-11(18)15(10)9-3-1-2-4-12(19)16-13(20)7-8-14(16)21/h5-8,20-21H,1-4,9H2 |
| InChIKey | IUDZBTTYJHUXAL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|