C15H18N2O4 — CID 54025835
1-[[4-(2,5-dihydroxypyrrol-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 54025835) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[[4-(2,5-dihydroxypyrrol-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione.
| Compound Name | 1-[[4-(2,5-dihydroxypyrrol-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 54025835 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[[4-(2,5-dihydroxypyrrol-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC1CCC(n2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C15H18N2O4/c18-12-5-6-13(19)16(12)9-10-1-3-11(4-2-10)17-14(20)7-8-15(17)21/h5-8,10-11,20-21H,1-4,9H2 |
| InChIKey | LCCLEQDDNPFJNL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|