C16H18N2O7 — CID 54042542
[1-(2,5-dihydroxypyrrol-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] hydrogen carbonate (PubChem CID 54042542) has the molecular formula C16H18N2O7 and a molecular weight of 350.33 g/mol. Its IUPAC name is [1-(2,5-dihydroxypyrrol-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] hydrogen carbonate.
| Compound Name | [1-(2,5-dihydroxypyrrol-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 54042542 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [1-(2,5-dihydroxypyrrol-1-yl)-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] hydrogen carbonate |
| SMILES | O=C(O)OC1(n2c(O)ccc2O)CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C16H18N2O7/c19-11-1-2-12(20)17(11)9-10-5-7-16(8-6-10,25-15(23)24)18-13(21)3-4-14(18)22/h1-4,10,21-22H,5-9H2,(H,23,24) |
| InChIKey | LNISOZODGADNMQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|