C16H18N2O6 — CID 54294139
4-[[3-(2,5-dihydroxypyrrol-1-yl)-2,5-dioxopyrrol-1-yl]methyl]cyclohexane-1-carboxylic acid (PubChem CID 54294139) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 4-[[3-(2,5-dihydroxypyrrol-1-yl)-2,5-dioxopyrrol-1-yl]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(2,5-dihydroxypyrrol-1-yl)-2,5-dioxopyrrol-1-yl]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 54294139 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[[3-(2,5-dihydroxypyrrol-1-yl)-2,5-dioxopyrrol-1-yl]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=C(n3c(O)ccc3O)C2=O)CC1 |
| InChI | InChI=1S/C16H18N2O6/c19-12-5-6-13(20)18(12)11-7-14(21)17(15(11)22)8-9-1-3-10(4-2-9)16(23)24/h5-7,9-10,19-20H,1-4,8H2,(H,23,24) |
| InChIKey | RZPAKUCFNLOPOT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|