C16H20N2O5 — CID 123830642
1-[[4-[(2,5-dihydroxypyrrol-1-yl)oxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 123830642) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-[[4-[(2,5-dihydroxypyrrol-1-yl)oxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione.
| Compound Name | 1-[[4-[(2,5-dihydroxypyrrol-1-yl)oxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 123830642 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[[4-[(2,5-dihydroxypyrrol-1-yl)oxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC1CCC(COn2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C16H20N2O5/c19-13-5-6-14(20)17(13)9-11-1-3-12(4-2-11)10-23-18-15(21)7-8-16(18)22/h5-8,11-12,21-22H,1-4,9-10H2 |
| InChIKey | YBYRMYUXJIGINI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|