C18H20N2O9 — CID 123705414
(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxymethyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 123705414) has the molecular formula C18H20N2O9 and a molecular weight of 408.36 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl)oxycarbonyloxymethyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl)oxycarbonyloxymethyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123705414 |
| Molecular Formula | C18H20N2O9 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl)oxycarbonyloxymethyl 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(OCOC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)On1c(O)ccc1O |
| InChI | InChI=1S/C18H20N2O9/c21-13-5-6-14(22)19(13)9-11-1-3-12(4-2-11)17(25)27-10-28-18(26)29-20-15(23)7-8-16(20)24/h5-8,11-12,23-24H,1-4,9-10H2 |
| InChIKey | OMIVYTHXZCQRIW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|