C16H18N2O10S — CID 91264950
1-[1-carboxyoxy-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91264950) has the molecular formula C16H18N2O10S and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-[1-carboxyoxy-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[1-carboxyoxy-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91264950 |
| Molecular Formula | C16H18N2O10S |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-[1-carboxyoxy-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(O)OC1(n2c(O)cc(S(=O)(=O)O)c2O)CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C16H18N2O10S/c19-11-1-2-12(20)17(11)8-9-3-5-16(6-4-9,28-15(23)24)18-13(21)7-10(14(18)22)29(25,26)27/h1-2,7,9,21-22H,3-6,8H2,(H,23,24)(H,25,26,27) |
| InChIKey | IVULPNWBUKHHHQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 183.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|