C15H16N2O9S — CID 90910704
1-[4-(2,5-dioxopyrrol-1-yl)cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 90910704) has the molecular formula C15H16N2O9S and a molecular weight of 400.37 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrol-1-yl)cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4-(2,5-dioxopyrrol-1-yl)cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 90910704 |
| Molecular Formula | C15H16N2O9S |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrol-1-yl)cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(On1c(O)cc(S(=O)(=O)O)c1O)C1CCC(N2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C15H16N2O9S/c18-11-5-6-12(19)16(11)9-3-1-8(2-4-9)15(22)26-17-13(20)7-10(14(17)21)27(23,24)25/h5-9,20-21H,1-4H2,(H,23,24,25) |
| InChIKey | RMUHFWAYLNSECV-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|