C16H18N2O9S — CID 90944585
[2,5-dihydroxy-3-(trioxidanylsulfanyl)pyrrol-1-yl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 90944585) has the molecular formula C16H18N2O9S and a molecular weight of 414.39 g/mol. Its IUPAC name is [2,5-dihydroxy-3-(trioxidanylsulfanyl)pyrrol-1-yl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | [2,5-dihydroxy-3-(trioxidanylsulfanyl)pyrrol-1-yl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90944585 |
| Molecular Formula | C16H18N2O9S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [2,5-dihydroxy-3-(trioxidanylsulfanyl)pyrrol-1-yl] 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(On1c(O)cc(SOOO)c1O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C16H18N2O9S/c19-12-5-6-13(20)17(12)8-9-1-3-10(4-2-9)16(23)25-18-14(21)7-11(15(18)22)28-27-26-24/h5-7,9-10,21-22,24H,1-4,8H2 |
| InChIKey | UROYAYMLDKZJNL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|