C25H36N2O9S — CID 91303854
1-[1-[9-(2,5-dioxopyrrol-1-yl)nonyl]cycloheptanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91303854) has the molecular formula C25H36N2O9S and a molecular weight of 540.64 g/mol. Its IUPAC name is 1-[1-[9-(2,5-dioxopyrrol-1-yl)nonyl]cycloheptanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[1-[9-(2,5-dioxopyrrol-1-yl)nonyl]cycloheptanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91303854 |
| Molecular Formula | C25H36N2O9S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 1-[1-[9-(2,5-dioxopyrrol-1-yl)nonyl]cycloheptanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C1C=CC(=O)N1CCCCCCCCCC1(C(=O)On2c(O)cc(S(=O)(=O)O)c2O)CCCCCC1 |
| InChI | InChI=1S/C25H36N2O9S/c28-20-12-13-21(29)26(20)17-11-7-3-1-2-4-8-14-25(15-9-5-6-10-16-25)24(32)36-27-22(30)18-19(23(27)31)37(33,34)35/h12-13,18,30-31H,1-11,14-17H2,(H,33,34,35) |
| InChIKey | DUXHQSQNVSOIDU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|