C16H16N2O9S — CID 91571563
1-[4-[(2,5-dioxopyrrol-1-yl)methylidene]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 91571563) has the molecular formula C16H16N2O9S and a molecular weight of 412.38 g/mol. Its IUPAC name is 1-[4-[(2,5-dioxopyrrol-1-yl)methylidene]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[4-[(2,5-dioxopyrrol-1-yl)methylidene]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 91571563 |
| Molecular Formula | C16H16N2O9S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 1-[4-[(2,5-dioxopyrrol-1-yl)methylidene]cyclohexanecarbonyl]oxy-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | O=C(On1c(O)cc(S(=O)(=O)O)c1O)C1CCC(=CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C16H16N2O9S/c19-12-5-6-13(20)17(12)8-9-1-3-10(4-2-9)16(23)27-18-14(21)7-11(15(18)22)28(24,25)26/h5-8,10,21-22H,1-4H2,(H,24,25,26)/b9-8- |
| InChIKey | YPMZVVFCHCQNQE-HJWRWDBZSA-N |
| XLogP | 0.10 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|