C16H18N2O6 — CID 54329280
2-(2,5-dihydroxypyrrol-1-yl)-1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 54329280) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 54329280 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-1-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C1C=CC(=O)N1CC1(C(=O)O)CCCCC1n1c(O)ccc1O |
| InChI | InChI=1S/C16H18N2O6/c19-11-4-5-12(20)17(11)9-16(15(23)24)8-2-1-3-10(16)18-13(21)6-7-14(18)22/h4-7,10,21-22H,1-3,8-9H2,(H,23,24) |
| InChIKey | SXEPRTZSZFLOQC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|